BIOPEP-UWM: Report
ID | 3763 |
Name |
sequence |
Function: | |||
Number of residues | 4 |
Activity code | ah |
Activity : | ACE inhibitor |
|||
Chemical mass | 413.4674 | Monoisotopic mass | 413.2267 | |
EC50 : | 312.00 µM |
Bibliographic data: | |
Authors | |
Yano S., Suzuki K., Funatsu G. | |
Title | |
Isolation from a-zein of thermolysin peptides with angiotensin I-converting enzyme inhibitory activity. Biosci.Biotech.Biochem.60(4),661-663(1996) | |
Year | Source |
1996 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C18H31N5O6/c1-9(2)7-11(19)15(25)22-12(8-14(20)24)17(27)23-6-4-5-13(23)16(26)21-10(3)18(28)29/h9-13H,4-8,19H2,1-3H3,(H2,20,24)(H,21,26)(H,22,25)(H,28,29)/t10-,11-,12-,13-/m0/s1 InChIKey=PWBYMXCUFPVRNL-CYDGBPFRSA-N |
Database reference: |