BIOPEP-UWM: Report
ID | 3768 |
Name | dipeptidyl carboxypeptidase inhibitor |
sequence |
Function: | |||
dipeptidyl carboxypeptidase inhibitor | |||
Number of residues | 4 |
Activity code | inh |
Activity : | inhibitor |
|||
Chemical mass | 396.4370 | Monoisotopic mass | 396.2002 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Maruyama S., Miyoshi S., Nomura G., Suzuki M., Tanaka H., Maeda H. | |
Title | |
Specifity for various imino-acid-residues of a proline-specific dipeptidylcarboxypeptidase from a Streptomyces species.Bioch.Biophys.Acta 1162,72-76 | |
Year | Source |
1993 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CO)(NC(=O)[C@]1([H])CCCN1C(=O)[C@]1([H])CCCN1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C18H28N4O6/c23-10-12(17(26)22-9-3-6-14(22)18(27)28)20-15(24)13-5-2-8-21(13)16(25)11-4-1-7-19-11/h11-14,19,23H,1-10H2,(H,20,24)(H,27,28)/t11-,12-,13-,14-/m0/s1 InChIKey=RUEUALCDUMDFSW-XUXIUFHCSA-N |
Database reference: |