BIOPEP-UWM: Report
| ID | 3772 |
| Name | peptide from soybean b-conglycinin (Glycine max) |
| sequence |
| Function: | |||
| Peptide obtained by hydrolysis of a soybean b-conglycinin (Glycine max) by use of protease S. | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 615.7225 | Monoisotopic mass | 615.3483 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen H.-M., Muramoto K., Yamauchi F. | |
| Title | |
| Structural analysis of antioxidative peptides from soybean b-conglycynin. J. Agric. Food Chem., 43 (1995), 574-578. | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]cn1)C(O)=O InChI=1S/C29H45N9O6/c1-16(2)8-20(30)25(39)36-22(9-17(3)4)28(42)38-7-5-6-24(38)27(41)35-21(10-18-12-31-14-33-18)26(40)37-23(29(43)44)11-19-13-32-15-34-19/h12-17,20-24H,5-11,30H2,1-4H3,(H,31,33)(H,32,34)(H,35,41)(H,36,39)(H,37,40)(H,43,44)/t20-,21-,22-,23-,24-/m0/s1 InChIKey=WPLGSZNSEQILJO-LSBAASHUSA-N |
| Database reference: |