BIOPEP-UWM: Report
| ID | 3777 |
| Name | dipeptidyl carboxypeptidase inhibitor |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | inh |
| Activity : | inhibitor |
|||
| Chemical mass | 438.4736 | Monoisotopic mass | 438.2107 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Nomura G., Suzuki M., Tanaka H., Maeda H. | |
| Title | |
| Specifity for various imino-acid-residues of a proline-specific dipeptidylcarboxypeptidase from a Streptomyces species.Bioch.Biophys.Acta 1162,72-76 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCC(O)=O)(NC(=O)[C@]1([H])CCCN1C(=O)[C@]1([H])CCCN1C(=O)[C@]1([H])CCCN1)C(O)=O InChI=1S/C20H30N4O7/c25-16(26)8-7-13(20(30)31)22-17(27)14-5-2-10-23(14)19(29)15-6-3-11-24(15)18(28)12-4-1-9-21-12/h12-15,21H,1-11H2,(H,22,27)(H,25,26)(H,30,31)/t12-,13-,14-,15-/m0/s1 InChIKey=VGZGXDAWIVYYOZ-AJNGGQMLSA-N |
| Database reference: |