BIOPEP-UWM: Report
| ID | 3781 |
| Name | dipeptidyl carboxypeptidase inhibitor |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | inh |
| Activity : | inhibitor |
|||
| Chemical mass | 366.4111 | Monoisotopic mass | 366.1897 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Maruyama S., Miyoshi S., Nomura G., Suzuki M., Tanaka H., Maeda H. | |
| Title | |
| Specifity for various imino-acid-residues of a proline-specific dipeptidylcarboxypeptidase from a Streptomyces species.Bioch.Biophys.Acta 1162,72-76 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@]1(CCCN1)C(=O)N1CCC[C@@]1([H])C(=O)N1CCC[C@@]1([H])C(=O)NCC(O)=O InChI=1S/C17H26N4O5/c22-14(23)10-19-15(24)12-5-2-8-20(12)17(26)13-6-3-9-21(13)16(25)11-4-1-7-18-11/h11-13,18H,1-10H2,(H,19,24)(H,22,23)/t11-,12-,13-/m0/s1 InChIKey=AEIIAAHRDFMWOM-AVGNSLFASA-N |
| Database reference: |