BIOPEP-UWM: Report
ID | 3785 |
Name |
sequence |
Function: | |||
Number of residues | 3 |
Activity code | op |
Activity : | opioid |
|||
Chemical mass | 441.4759 | Monoisotopic mass | 441.1893 | |
EC50 : | 1000.00 µM |
Bibliographic data: | |
Authors | |
Fukudome S., Yoshikawa M. | |
Title | |
Opioid peptides derived from wheat gluten: their isolation and characterization.FEBS Lett.296(1),107-111(1992) | |
Year | Source |
1994 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C23H27N3O6/c24-18(12-14-3-7-16(27)8-4-14)21(29)25-19(13-15-5-9-17(28)10-6-15)22(30)26-11-1-2-20(26)23(31)32/h3-10,18-20,27-28H,1-2,11-13,24H2,(H,25,29)(H,31,32)/t18-,19-,20-/m0/s1 InChIKey=KHPLUFDSWGDRHD-UFYCRDLUSA-N |
Database reference: |