BIOPEP-UWM: Report
| ID | 3793 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 555.6294 | Monoisotopic mass | 555.3233 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yoshikawa M., Kishi K., Takahashi M., Watanabe A., Miyamura T., Yamamzaki M., Ch | |
| Title | |
| Immunostimulating peptide derived from soybean protein. Ann.New York Acad.of Siences 1993, 375-376 | |
| Year | Source |
| 1993 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(N)=O)C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C22H41N11O6/c23-12(7-8-16(24)34)17(35)31-13(4-1-9-29-21(25)26)19(37)33-11-3-6-15(33)18(36)32-14(20(38)39)5-2-10-30-22(27)28/h12-15H,1-11,23H2,(H2,24,34)(H,31,35)(H,32,36)(H,38,39)(H4,25,26,29)(H4,27,28,30)/t12-,13-,14-,15-/m0/s1 InChIKey=QGXHEXJEKDVBEE-AJNGGQMLSA-N |
| Database reference: |