BIOPEP-UWM: Report
| ID | 3795 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | op |
| Activity : | opioid |
|||
| Chemical mass | 642.7495 | Monoisotopic mass | 642.3382 | |
| EC50 : | 0.01 µM |
|||
| Bibliographic data: | |
| Authors | |
| Dooley C.T., Kaplan R.A., Chung N.N., Schiller P.W., Bidlack J.M., Houghten R.A. | |
| Title | |
| Six highly active mu-selective opioid peptides identified from two synthetic combinatorial libraries. Peptide Research, 8, 3, 124-137(1995) | |
| Year | Source |
| 1995 | Journal |
| Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCNC(N)=N)(NC(=O)[C@]1([H])CCCN1C(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(N)=O InChI=1S/C33H42N10O4/c34-23(15-19-17-39-24-9-3-1-7-21(19)24)30(45)42-27(16-20-18-40-25-10-4-2-8-22(20)25)32(47)43-14-6-12-28(43)31(46)41-26(29(35)44)11-5-13-38-33(36)37/h1-4,7-10,17-18,23,26-28,39-40H,5-6,11-16,34H2,(H2,35,44)(H,41,46)(H,42,45)(H4,36,37,38)/t23-,26-,27-,28-/m0/s1 InChIKey=ZKLOZMRNUSSLPQ-WHHDSKRTSA-N Originally EC50 was expressed in [nM], in BIOPEP-UWM EC50 value was transformed to [uM]. |
| Database reference: |