BIOPEP-UWM: Report
| ID | 3864 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 617.6921 | Monoisotopic mass | 617.3163 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Siemion I. Z., Kluczyk A., Wieczorek Z. | |
| Title | |
| Anti-IL-1 activity of peptide fragments of IL-1 family proteins. Peptides 19, 2, 373-382 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](CCCCN)(NC(=O)[C@]1([H])CCCN1)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C29H43N7O8/c30-12-2-1-5-20(33-25(39)19-6-3-13-32-19)26(40)34-21(16-24(31)38)27(41)35-22(15-17-8-10-18(37)11-9-17)28(42)36-14-4-7-23(36)29(43)44/h8-11,19-23,32,37H,1-7,12-16,30H2,(H2,31,38)(H,33,39)(H,34,40)(H,35,41)(H,43,44)/t19-,20-,21-,22-,23-/m0/s1 InChIKey=JHLBIRBXLYZMMH-VUBDRERZSA-N |
| Database reference: |