BIOPEP-UWM: Report
| ID | 3884 |
| Name | temporin C |
| sequence |
| Function: | |||
| temporins derive from Rana temporaria, they are active againts E. Coli and B.megaterium | |||
| Number of residues | 13 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1361.7101 | Monoisotopic mass | 1360.8779 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Simmaco M., Mignogna G., Canofeni S., Miele R., Mangoni M. L., Barra D. | |
| Title | |
| Temporins, antimicrobial peptides from the European red frog Rana temporaria. Eur.J.Biochem., 242, 788-792 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(N)=O)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(N)=O)[C@@]([H])(C)CC InChI=1S/C65H116N16O15/c1-17-39(16)54(80-63(94)49-19-18-20-81(49)65(96)48(27-38(14)15)79-56(87)40(66)21-32(2)3)64(95)78-42(23-34(6)7)57(88)70-31-53(85)73-47(29-51(68)83)62(93)76-44(25-36(10)11)60(91)75-45(26-37(12)13)61(92)77-46(28-50(67)82)58(89)71-30-52(84)72-43(24-35(8)9)59(90)74-41(55(69)86)22-33(4)5/h32-49,54H,17-31,66H2,1-16H3,(H2,67,82)(H2,68,83)(H2,69,86)(H,70,88)(H,71,89)(H,72,84)(H,73,85)(H,74,90)(H,75,91)(H,76,93)(H,77,92)(H,78,95)(H,79,87)(H,80,94)/t39-,40-,41-,42-,43-,44-,45-,46-,47-,48-,49-,54-/m0/s1 InChIKey=SGDNFGVOWDPHIK-NVLKNSNSSA-N |
| Database reference: |