BIOPEP-UWM: Report
| ID | 3888 |
| Name | temporin E |
| sequence |
| Function: | |||
| temporins derive from Rana temporaria, they are active againts E. Coli and B.megaterium | |||
| Number of residues | 13 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1377.7095 | Monoisotopic mass | 1376.8728 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Simmaco M., Mignogna G., Canofeni S., Miele R., Mangoni M. L., Barra D. | |
| Title | |
| Temporins, antimicrobial peptides from the European red frog Rana temporaria. Eur.J.Biochem., 242, 788-792 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(NC(=O)[C@@]([H])(NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CC(C)C)NC(=O)[C@@]([H])(N)C(C)C)[C@@]([H])(C)CC)C(=O)NCC(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(N)=O InChI=1S/C65H116N16O16/c1-17-37(15)52(80-64(96)53(38(16)18-2)79-61(93)47-20-19-21-81(47)65(97)45(26-35(11)12)77-62(94)51(68)36(13)14)63(95)70-29-50(85)71-43(27-48(66)83)58(90)74-41(24-33(7)8)56(88)73-42(25-34(9)10)57(89)76-44(28-49(67)84)59(91)78-46(30-82)60(92)75-40(23-32(5)6)55(87)72-39(54(69)86)22-31(3)4/h31-47,51-53,82H,17-30,68H2,1-16H3,(H2,66,83)(H2,67,84)(H2,69,86)(H,70,95)(H,71,85)(H,72,87)(H,73,88)(H,74,90)(H,75,92)(H,76,89)(H,77,94)(H,78,91)(H,79,93)(H,80,96)/t37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,51-,52-,53-/m0/s1 InChIKey=GPIZFHFJBJAIOT-VHNNCPOXSA-N |
| Database reference: |