BIOPEP-UWM: Report
| ID | 3890 |
| Name | temporin F |
| sequence |
| Function: | |||
| temporins derive from Rana temporaria, they are active againts E. Coli and B.megaterium | |||
| Number of residues | 13 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1368.7440 | Monoisotopic mass | 1367.8877 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Simmaco M., Mignogna G., Canofeni S., Miele R., Mangoni M. L., Barra D. | |
| Title | |
| Temporins, antimicrobial peptides from the European red frog Rana temporaria. Eur.J.Biochem., 242, 788-792 | |
| Year | Source |
| 1996 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccccc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@]([H])(C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@]([H])(C(=O)N[C@@]([H])(CC(C)C)C(N)=O)[C@@]([H])(C)CC)[C@@]([H])(C)CC InChI=1S/C68H117N15O14/c1-15-42(13)56(82-63(92)49(31-39(7)8)76-64(93)52-26-22-28-83(52)68(97)50(32-40(9)10)78-59(88)45(70)33-44-23-18-17-19-24-44)65(94)73-34-53(85)74-46(25-20-21-27-69)61(90)81-55(41(11)12)66(95)77-48(30-38(5)6)62(91)79-51(36-84)60(89)72-35-54(86)80-57(43(14)16-2)67(96)75-47(58(71)87)29-37(3)4/h17-19,23-24,37-43,45-52,55-57,84H,15-16,20-22,25-36,69-70H2,1-14H3,(H2,71,87)(H,72,89)(H,73,94)(H,74,85)(H,75,96)(H,76,93)(H,77,95)(H,78,88)(H,79,91)(H,80,86)(H,81,90)(H,82,92)/t42-,43-,45-,46-,47-,48-,49-,50-,51-,52-,55-,56-,57-/m0/s1 InChIKey=XNQGMOIDHKOVFC-FEFFWNQGSA-N |
| Database reference: |