BIOPEP-UWM: Report
| ID | 3969 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 741.7927 | Monoisotopic mass | 741.3548 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Matoba N. et al. | |
| Title | |
| A novel anti-hypertensive peptide derived from ovalbumin induces nitric oxide-mediated vasorelaxation in an isolated SHR mesenteric artery.FEBS Lett., 452, 181-184 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCCNC(N)=N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C33H47N11O9/c1-18(40-28(48)21(34)9-5-11-38-33(35)36)27(47)41-22(15-26(45)46)29(49)42-23(14-20-16-37-17-39-20)31(51)44-12-6-10-25(44)30(50)43-24(32(52)53)13-19-7-3-2-4-8-19/h2-4,7-8,16-18,21-25H,5-6,9-15,34H2,1H3,(H,37,39)(H,40,48)(H,41,47)(H,42,49)(H,43,50)(H,45,46)(H,52,53)(H4,35,36,38)/t18-,21-,22-,23-,24-,25-/m0/s1 InChIKey=UPBCMRNBWQURFH-LHOYKQQOSA-N |
| Database reference: |