BIOPEP-UWM: Report
| ID | 3970 |
| Name | ACE inhibitor (fragment of alpha-lactalbumin: 104-108) |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 653.7704 | Monoisotopic mass | 653.3639 | |
| IC50 : | 77.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppala A., Koskinen P., Piilola K., Tupasela T., Korhonen H. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides. J. Dairy Res., 67, 53-64, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C32H47N9O6/c1-18(2)12-26(41-29(43)23(34)13-20-15-36-24-9-5-4-8-22(20)24)30(44)38-19(3)28(42)40-27(14-21-16-35-17-37-21)31(45)39-25(32(46)47)10-6-7-11-33/h4-5,8-9,15-19,23,25-27,36H,6-7,10-14,33-34H2,1-3H3,(H,35,37)(H,38,44)(H,39,45)(H,40,42)(H,41,43)(H,46,47)/t19-,23-,25-,26-,27-/m0/s1 InChIKey=JOTYPHSZHCKJSP-HUBZGTFKSA-N Osteoanabolic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10410); the MBPDB database Immunomodulating peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10859) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10410; 10859 ChemSpider: ID 8614689 DFBP: ID DFBPACEI0353 EROP-Moscow: ID E04793 FeptideDB: ID 3970 J-GLOBAL: ID 200907000097318697 MBPDB: Peptide WLAHK Nikkaji: ID J1.972.790D Peptipedia: ID 929 PubChem: CID 10439268 |