BIOPEP-UWM: Report
| ID | 3971 |
| Name | ACE inhibitor (fragment of bovine a-La) |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1200.3848 | Monoisotopic mass | 1199.6432 | |
| IC50 : | 327.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppälä A., Koskinen P., Piilola K., Tupasela T., Korhonen H. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides.J. Dairy Res., 67, 53-64, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C58H85N15O13/c1-8-32(6)49(73-47(76)28-64-56(83)48(61)31(4)5)57(84)72-45(25-46(60)75)55(82)70-42(22-34-16-18-37(74)19-17-34)52(79)71-43(23-35-26-63-39-14-10-9-13-38(35)39)53(80)69-41(21-30(2)3)51(78)66-33(7)50(77)68-44(24-36-27-62-29-65-36)54(81)67-40(58(85)86)15-11-12-20-59/h9-10,13-14,16-19,26-27,29-33,40-45,48-49,63,74H,8,11-12,15,20-25,28,59,61H2,1-7H3,(H2,60,75)(H,62,65)(H,64,83)(H,66,78)(H,67,81)(H,68,77)(H,69,80)(H,70,82)(H,71,79)(H,72,84)(H,73,76)(H,85,86)/t32-,33-,40-,41-,42-,43-,44-,45-,48-,49-/m0/s1 InChIKey=ZYIXBRULWUVEPE-AWOWTVRJSA-N |
| Database reference: |
| AHTPDB: ID 1197, 3342, 6479 DFBP: ID DFBPACEI0354 EROP-Moscow: ID E04792 MBPDB: peptide VGINYWLAHK J-GLOBAL: ID 200907095639872557 |