BIOPEP-UWM: Report
| ID | 3975 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 342.4326 | Monoisotopic mass | 342.2260 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppälä A., Koskinen P., Piilola K., Tupasela T., Korhonen H. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides. J. Dairy Res., 67, 53-64, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C16H30N4O4/c1-10(2)13(18)15(22)20-9-5-7-12(20)14(21)19-11(16(23)24)6-3-4-8-17/h10-13H,3-9,17-18H2,1-2H3,(H,19,21)(H,23,24)/t11-,12-,13-/m0/s1 InChIKey=BGXVHVMJZCSOCA-AVGNSLFASA-N |
| Database reference: |
| AHTPDB: ID 6482 BioPepDB: ID biopep01430 FeptideDB: ID 3975 PubChem: CID 145459026 SATPdb: ID satpdb23543 |