BIOPEP-UWM: Report
| ID | 3977 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 9 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 970.0783 | Monoisotopic mass | 969.5227 | |
| IC50 : | 635.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppala A. et al. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides.J. Dairy Res., 67, 53-64 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(N)=O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(N)=N)C(O)=O InChI=1S/C41H71N13O14/c1-19(2)15-23(42)33(60)51-27(17-31(57)58)35(62)47-21(5)32(59)49-24(11-12-30(43)56)34(61)53-28(18-55)37(64)48-22(6)39(66)54-14-8-10-29(54)38(65)52-26(16-20(3)4)36(63)50-25(40(67)68)9-7-13-46-41(44)45/h19-29,55H,7-18,42H2,1-6H3,(H2,43,56)(H,47,62)(H,48,64)(H,49,59)(H,50,63)(H,51,60)(H,52,65)(H,53,61)(H,57,58)(H,67,68)(H4,44,45,46)/t21-,22-,23-,24-,25-,26-,27-,28-,29-/m0/s1 InChIKey=RKWRGVFAKJIMRN-NVRHUXBUSA-N |
| Database reference: |