BIOPEP-UWM: Report
| ID | 3978 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 653.7267 | Monoisotopic mass | 653.2140 | |
| IC50 : | 788.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppala A. et al. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides.J. Dairy Res., 67, 53-64 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CS)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(CC(N)=O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(O)=O InChI=1S/C23H39N7O11S2/c1-10(23(40)41)26-22(39)15(8-31)30-21(38)14(7-16(25)32)29-19(36)12(3-4-17(33)34)28-20(37)13(5-6-43-2)27-18(35)11(24)9-42/h10-15,31,42H,3-9,24H2,1-2H3,(H2,25,32)(H,26,39)(H,27,35)(H,28,37)(H,29,36)(H,30,38)(H,33,34)(H,40,41)/t10-,11-,12-,13-,14-,15-/m0/s1 InChIKey=SBIFIUSJSNDFBH-LZXPERKUSA-N |
| Database reference: |