BIOPEP-UWM: Report
| ID | 3979 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 852.9258 | Monoisotopic mass | 852.4214 | |
| IC50 : | 946.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppala A. et al. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides.J. Dairy Res., 67, 53-64 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]([H])(CC(O)=O)NC(=O)[C@]([H])(CC(C)C)NC(=O)[C@@]([H])(N)C(C)C)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C38H60N8O14/c1-18(2)14-24(44-36(57)30(40)19(3)4)32(53)43-27(17-29(51)52)35(56)46-31(20(5)47)37(58)45-26(16-28(49)50)34(55)42-25(15-21-9-11-22(48)12-10-21)33(54)41-23(38(59)60)8-6-7-13-39/h9-12,18-20,23-27,30-31,47-48H,6-8,13-17,39-40H2,1-5H3,(H,41,54)(H,42,55)(H,43,53)(H,44,57)(H,45,58)(H,46,56)(H,49,50)(H,51,52)(H,59,60)/t20-,23+,24+,25+,26+,27+,30+,31+/m1/s1 InChIKey=NHWGJDKVDDBRRV-DPSUHZEXSA-N |
| Database reference: |