BIOPEP-UWM: Report
| ID | 3980 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 532.5879 | Monoisotopic mass | 532.2637 | |
| IC50 : | 534.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pihlanto-Leppala A. et al. | |
| Title | |
| Angiotensin I-converting enzyme inhibitory properties of whey protein digests: concentration and characterization of active peptides.J. Dairy Res., 67, 53-64 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)CNC(=O)[C@]([H])(C)NC(=O)[C@@]([H])(N)C(C)C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(O)=O InChI=1S/C25H36N6O7/c1-12(2)20(26)23(35)29-13(3)22(34)28-11-19(33)31-21(14(4)32)24(36)30-18(25(37)38)9-15-10-27-17-8-6-5-7-16(15)17/h5-8,10,12-14,18,20-21,27,32H,9,11,26H2,1-4H3,(H,28,34)(H,29,35)(H,30,36)(H,31,33)(H,37,38)/t13-,14+,18-,20-,21-/m0/s1 InChIKey=UDJYYBCFIYCUSO-QAJIRISXSA-N |
| Database reference: |