BIOPEP-UWM: Report
| ID | 3985 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 8 |
Activity code | is |
| Activity : | immunostimulating |
|||
| Chemical mass | 956.1653 | Monoisotopic mass | 955.5370 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Siemion I. Z. et al. | |
| Title | |
| Length of chain influences the immunomodulatory activity of peptides related to p53 protein.Peptides, 20, 995-998 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(NC(=O)[C@]1([H])CCCN1C(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]([H])(CCCNC(N)=N)NC(=O)[C@]([H])(CC(N)=O)NC(=O)[C@]([H])(CCSC)NC(=O)CN)C(=O)N[C@@]([H])(CC(C)C)C(O)=O InChI=1S/C40H73N15O10S/c1-6-22(4)31(36(62)53-27(38(64)65)18-21(2)3)54-35(61)28-12-9-16-55(28)37(63)25(11-8-15-48-40(45)46)51-32(58)23(10-7-14-47-39(43)44)50-34(60)26(19-29(42)56)52-33(59)24(13-17-66-5)49-30(57)20-41/h21-28,31H,6-20,41H2,1-5H3,(H2,42,56)(H,49,57)(H,50,60)(H,51,58)(H,52,59)(H,53,62)(H,54,61)(H,64,65)(H4,43,44,47)(H4,45,46,48)/t22-,23-,24-,25-,26-,27-,28-,31-/m0/s1 InChIKey=SVVOZTXHONPTMH-OHVRIHCTSA-N |
| Database reference: |