BIOPEP-UWM: Report
| ID | 3988 |
| Name | Human urotensin II |
| sequence |
| Function: | |||
| Number of residues | 11 |
Activity code | vsc |
| Activity : | vasoconstrictor |
|||
| Chemical mass | 1390.5806 | Monoisotopic mass | 1389.5713 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ames R. S. et al. | |
| Title | |
| Human urotensin II is a potent vasoconstrictor and agonist for the orphan receptor GPR14.Nature, 401, 282-286 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| Active in cyclic form. The disulphide bond occurs between Cys5 and Cys10. The -LogEC50 values, measured using different vessels are between 9 and 10 (EC50 expressed in nm). The molecular masses are calculated for reduced form. BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(O)=O)C(=O)N[C@]([H])(C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(C(C)C)C(O)=O)[C@@]([H])(C)O InChI=1S/C64H87N13O18S2/c1-33(2)52(64(94)95)75-61(91)48(32-97)74-57(87)44(27-36-18-20-38(79)21-19-36)69-55(85)42(16-9-10-24-65)68-58(88)45(28-37-30-67-41-15-8-7-14-39(37)41)71-56(86)43(26-35-12-5-4-6-13-35)70-60(90)47(31-96)73-59(89)46(29-51(82)83)72-62(92)49-17-11-25-77(49)63(93)53(34(3)78)76-54(84)40(66)22-23-50(80)81/h4-8,12-15,18-21,30,33-34,40,42-49,52-53,67,78-79,96-97H,9-11,16-17,22-29,31-32,65-66H2,1-3H3,(H,68,88)(H,69,85)(H,70,90)(H,71,86)(H,72,92)(H,73,89)(H,74,87)(H,75,91)(H,76,84)(H,80,81)(H,82,83)(H,94,95)/t34-,40+,42+,43+,44+,45+,46+,47+,48+,49+,52+,53+/m1/s1 InChIKey=OFADXNWQLHHILF-USJMABIRSA-N |
| Database reference: |