BIOPEP-UWM: Report
| ID | 3989 |
| Name | Human urotensin II |
| sequence |
| Function: | |||
| Number of residues | 11 |
Activity code | orp |
| Activity : | orphan receptor GPR14 agonist |
|||
| Chemical mass | 1390.5806 | Monoisotopic mass | 1389.5713 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ames R. S. et al. | |
| Title | |
| Human urotensin II is a potent vasoconstrictor and agonist for the orphan receptor GPR14.Nature, 401, 282-286 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| Active in cyclic form. The disulphide bond occurs between Cys5 and Cys10. Activity measured using human orphan receptor. The EC50 against rat receptor is 0.00072 micromole. The molecular masses are calculated for reduced form. BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CCC(O)=O)C(=O)N[C@]([H])(C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(C(C)C)C(O)=O)[C@@]([H])(C)O InChI=1S/C64H87N13O18S2/c1-33(2)52(64(94)95)75-61(91)48(32-97)74-57(87)44(27-36-18-20-38(79)21-19-36)69-55(85)42(16-9-10-24-65)68-58(88)45(28-37-30-67-41-15-8-7-14-39(37)41)71-56(86)43(26-35-12-5-4-6-13-35)70-60(90)47(31-96)73-59(89)46(29-51(82)83)72-62(92)49-17-11-25-77(49)63(93)53(34(3)78)76-54(84)40(66)22-23-50(80)81/h4-8,12-15,18-21,30,33-34,40,42-49,52-53,67,78-79,96-97H,9-11,16-17,22-29,31-32,65-66H2,1-3H3,(H,68,88)(H,69,85)(H,70,90)(H,71,86)(H,72,92)(H,73,89)(H,74,87)(H,75,91)(H,76,84)(H,80,81)(H,82,83)(H,94,95)/t34-,40+,42+,43+,44+,45+,46+,47+,48+,49+,52+,53+/m1/s1 InChIKey=OFADXNWQLHHILF-USJMABIRSA-N |
| Database reference: |