BIOPEP-UWM: Report
| ID | 3992 |
| Name | f(45-48) of bovine lactoferrin |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 461.5791 | Monoisotopic mass | 461.2413 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Recio I., Visser S. | |
| Title | |
| Two ion-exchange chromatographic methods for the isolation of antibacterial peptides from lactoferrin. In situ enzymatic hydrolysis on an ion-exchange membrane. J. Chromatogr. A, 831, 191-201 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CS)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CCCNC(N)=N)C(=O)N[C@@]([H])(C)C(O)=O)[C@@]([H])(C)CC InChI=1S/C18H35N7O5S/c1-4-9(2)13(25-14(26)11(19)8-31)16(28)24-12(6-5-7-22-18(20)21)15(27)23-10(3)17(29)30/h9-13,31H,4-8,19H2,1-3H3,(H,23,27)(H,24,28)(H,25,26)(H,29,30)(H4,20,21,22)/t9-,10-,11-,12-,13-/m0/s1 InChIKey=XVDZARPTGZYTSO-VLJOUNFMSA-N |
| Database reference: |