BIOPEP-UWM: Report
| ID | 4003 |
| Name |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ne |
| Activity : | neuropeptide |
|||
| Chemical mass | 670.8186 | Monoisotopic mass | 670.3138 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| De Araujo J. E. et al. | |
| Title | |
| Anxiogenic effects of substance P and its 7-11 C-terminal, but not the 1-7 N-terminal, injected into the dorsal periaqueductal gray.Peptides, 20, 1437-1443 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)NCC(O)=O InChI=1S/C33H46N6O7S/c1-21(2)16-26(33(46)38-25(14-15-47-3)31(44)36-20-29(41)42)37-28(40)19-35-32(45)27(18-23-12-8-5-9-13-23)39-30(43)24(34)17-22-10-6-4-7-11-22/h4-13,21,24-27H,14-20,34H2,1-3H3,(H,35,45)(H,36,44)(H,37,40)(H,38,46)(H,39,43)(H,41,42)/t24-,25-,26-,27-/m0/s1 InChIKey=GOWRWKVCUSPDEO-FWEHEUNISA-N |
| Database reference: |