BIOPEP-UWM: Report
| ID | 4009 |
| Name | LTD 1 |
| sequence |
| Function: | |||
| Number of residues | 5 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 617.6904 | Monoisotopic mass | 617.3373 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pellegrini A. et al. | |
| Title | |
| Isolation and identification of three bactericidal domains in the bovine alpha-lactalbumin molecule.Biochim. Biophys. Acta, 1426, 439-448 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(O)[C@]([H])(NC(=O)[C@]([H])(CC(C)C)NC(=O)[C@]([H])(CCC(N)=O)NC(=O)[C@@]([H])(N)CCC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C26H47N7O10/c1-13(2)12-18(24(40)33-21(14(3)34)25(41)31-17(26(42)43)6-4-5-11-27)32-23(39)16(8-9-19(29)35)30-22(38)15(28)7-10-20(36)37/h13-18,21,34H,4-12,27-28H2,1-3H3,(H2,29,35)(H,30,38)(H,31,41)(H,32,39)(H,33,40)(H,36,37)(H,42,43)/t14-,15+,16+,17+,18+,21+/m1/s1 InChIKey=WKLHANNWPPADFA-GPCPFCKDSA-N |
| Database reference: |