BIOPEP-UWM: Report
| ID | 4011 |
| Name | LDT 2, beta-chain |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 649.7565 | Monoisotopic mass | 649.3094 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pellegrini A. et al. | |
| Title | |
| Isolation and identification of three bactericidal domains in the bovine alpha-lactalbumin molecule.Biochim. Biophys. Acta, 1426, 439-448 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](C)(N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(O)=O InChI=1S/C26H47N7O10S/c1-13(2)10-17(31-21(37)14(3)28)23(39)33-19(12-44)25(41)32-18(11-34)24(40)29-15(7-8-20(35)36)22(38)30-16(26(42)43)6-4-5-9-27/h13-19,34,44H,4-12,27-28H2,1-3H3,(H,29,40)(H,30,38)(H,31,37)(H,32,41)(H,33,39)(H,35,36)(H,42,43)/t14-,15-,16-,17-,18-,19-/m0/s1 InChIKey=SGCOTYFHECYTMV-DYKIIFRCSA-N |
| Database reference: |