BIOPEP-UWM: Report
| ID | 4013 |
| Name | LDC, beta-chain |
| sequence |
| Function: | |||
| Number of residues | 6 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 711.8258 | Monoisotopic mass | 711.3250 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pellegrini A. et al. | |
| Title | |
| Isolation and identification of three bactericidal domains in the bovine alpha-lactalbumin molecule.Biochim. Biophys. Acta, 1426, 439-448 | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(Cc1ccccc1)C(O)=O InChI=1S/C31H49N7O10S/c1-3-17(2)25(33)30(46)37-22(15-39)28(44)38-23(16-49)29(45)35-20(14-24(40)41)27(43)34-19(11-7-8-12-32)26(42)36-21(31(47)48)13-18-9-5-4-6-10-18/h4-6,9-10,17,19-23,25,39,49H,3,7-8,11-16,32-33H2,1-2H3,(H,34,43)(H,35,45)(H,36,42)(H,37,46)(H,38,44)(H,40,41)(H,47,48)/t17-,19-,20-,21-,22-,23-,25-/m0/s1 InChIKey=IEQBMTQYJVUPSG-ZXRIWIKRSA-N |
| Database reference: |