BIOPEP-UWM: Report
| ID | 4016 |
| Name | Cytotoxic peptide |
| sequence |
| Function: | |||
| Cytotoxic | |||
| Number of residues | 3 |
Activity code | tox |
| Activity : | toxic |
|||
| Chemical mass | 399.4871 | Monoisotopic mass | 399.2587 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otani H., Suzuki H. | |
| Title | |
| Isolation and characterization of cytotoxic small peptides, α-casecidins, from bovine α s1-casein digested with bovine trypsin. Anim. Sci. J., 74, 427–435, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C17H33N7O4/c18-8-2-1-6-12(16(27)28)23-14(25)13-7-4-10-24(13)15(26)11(19)5-3-9-22-17(20)21/h11-13H,1-10,18-19H2,(H,23,25)(H,27,28)(H4,20,21,22)/t11-,12-,13-/m0/s1 InChIKey=FVBZXNSRIDVYJS-AVGNSLFASA-N Anticancer peptide according to the BIOPEP-UWM database of bioactive peptides (ID 5472) Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 7440) |
| Database reference: |
| AHTPDB: ID 1585, 4279, 4309 BIOPEP-UWM database of bioactive peptides: ID 5472, 7440 CAS: Registry No 69355-87-9 ChEBI: ID 159260 ChemSpider: ID 57567899 EPA CompTox: ID DTXSID40559724 EROP-Moscow: ID E14711 J-Global: ID 200907034152208121 MBPDB: Peptide RPK Metabolomics Workbench: ID 79747 Nikkaji: ID J1.973.139A PubChem: CID 14389239 SATPdb: ID satpdb18173 |