BIOPEP-UWM: Report
| ID | 5456 |
| Name | Anticancer peptide |
| sequence |
| Function: | |||
| Anticancer | |||
| Number of residues | 3 |
Activity code | ac |
| Activity : | anticancer |
|||
| Chemical mass | 387.5160 | Monoisotopic mass | 387.2837 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otani H., Suzuki H. | |
| Title | |
| Isolation and characterization of cytotoxic small peptides, α-casecidins, from bovine α s1-casein digested with bovine trypsin. Anim. Sci. J., 74, 427–435, 2003 | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C18H37N5O4/c1-12(2)11-13(21)16(24)22-14(7-3-5-9-19)17(25)23-15(18(26)27)8-4-6-10-20/h12-15H,3-11,19-21H2,1-2H3,(H,22,24)(H,23,25)(H,26,27)/t13-,14-,15-/m0/s1 InChIKey=KPYAOIVPJKPIOU-KKUMJFAQSA-N Cytotoxic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 5458) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 5458 ChEBI: ID 159351 J-Global: ID 200907053319172463 MBPDB: Peptide LKK Metabolomics Workbench ID 83287 Nikkaji: ID J1.973.140E PubChem: CID 101265419 |