BIOPEP-UWM: Report
| ID | 5474 |
| Name | aurein 3.1.1 |
| sequence |
| Function: | |||
| Antimicrobial activity against L.lactis, M.luteus, P.multocida, S.aureus, S.epidermidis and S.uberis. Probably acts by disturbing membrane functions with its amphipathic structure. Shows anticancer activity. | |||
| Number of residues | 14 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1481.7758 | Monoisotopic mass | 1480.8739 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Rozek T., Wegener K.L., Bowie J.H., Olver I.N., Carver J.A., Wallace J.C., Tyler M.J.; | |
| Title | |
| "The antibiotic and anticancer active aurein peptides from the australian bell frogs Litoria aurea and Litoria raniformis the solution structure of aurein 1.2."; Eur. J. Biochem. 267:5330-5341. | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C70H116N18O17/c1-13-39(8)56(67(101)77-42(11)59(93)75-35-53(90)80-50(31-45-34-74-36-76-45)64(98)87-57(40(9)14-2)68(102)78-43(12)70(104)105)86-61(95)47(26-20-22-28-72)81-60(94)46(25-19-21-27-71)82-66(100)55(38(6)7)85-69(103)58(41(10)15-3)88-65(99)51(32-54(91)92)84-63(97)49(30-44-23-17-16-18-24-44)83-62(96)48(29-37(4)5)79-52(89)33-73/h16-18,23-24,34,36-43,46-51,55-58H,13-15,19-22,25-33,35,71-73H2,1-12H3,(H,74,76)(H,75,93)(H,77,101)(H,78,102)(H,79,89)(H,80,90)(H,81,94)(H,82,100)(H,83,96)(H,84,97)(H,85,103)(H,86,95)(H,87,98)(H,88,99)(H,91,92)(H,104,105)/t39-,40-,41-,42-,43-,46-,47-,48-,49-,50-,51-,55-,56-,57-,58-/m0/s1 InChIKey: FIMIVQFZGBEBHU-CPMIMXFSSA-N From Litoria raniformis (Southern bell frog), Litoria aurea (Green and golden bell frog). |
| Database reference: |
| SWISS-PROT AU31_LITRA |