BIOPEP-UWM: Report
| ID | 7414 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 473.5671 | Monoisotopic mass | 473.2743 | |
| IC50 : | 0.15 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu J., Yuan L., Aluko R. | |
| Title | |
| Restriction of the in vitro formation of angiotensin II by leucinyl-arginyl-tryptophan a novel peptide with potent angiotensin I converting inhibitory activity. Biosci. Biotechnol. Biochem., 70(5) 1277-1280, 2006 | |
| Year | Source |
| 2006 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)O InChI=1S/C23H35N7O4/c1-13(2)10-16(24)20(31)29-18(8-5-9-27-23(25)26)21(32)30-19(22(33)34)11-14-12-28-17-7-4-3-6-15(14)17/h3-4,6-7,12-13,16,18-19,28H,5,8-11,24H2,1-2H3,(H,29,31)(H,30,32)(H,33,34)(H4,25,26,27)/t16-,18-,19-/m0/s1 InChIKey=XYUBOFCTGPZFSA-WDSOQIARSA-N LRW was found within the primary structure of legumin A2 of a garden pea seeds (Pisum sativum) (position:377-379) and legumin A (position: 374-376). Peptide stimulating activity of osteoblasts according to the BIOPEP-UWM database of bioactive peptides (ID 9878) |
| Database reference: |
| AHTPDB: ID 1989 BioPepDB: ID biopep00889 BIOPEP-UWM database of bioactive peptides: ID 9878 EROP-Moscow: ID E23787 FeptideDB: ID 7414 ChemSpider: ID 16572302 MeSH: term Leu-Arg-Trp PlantPepDB: ID PPepDB_140 PubChem: CID 60206537 |