BIOPEP-UWM: Report
| ID | 7490 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 362.3795 | Monoisotopic mass | 362.1585 | |
| EC50 : | 464.60 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen G. W., Tsai J. S., Pan B. S. | |
| Title | |
| Purification of angiotensin I-converting inhibitory peptides and antihypertensive effect of milk produced by protease-facilitate lactic fermentation. Int. Dairy J., 2007, 17, 641-647 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@@](Cc1c[nH]c2ccccc12)(NC(=O)[C@@]([H])(NC(=O)CN)[C@@H](C)O)C(O)=O InChI= 1S/C17H22N4O5/c1-9(22)15(21-14(23)7-18)16(24)20-13(17(25)26)6-10-8-19-12-5-3-2-4-11(10)12/h2-5,8-9,13,15,19,22H,6-7,18H2,1H3,(H,20,24)(H,21,23)(H,25,26)/t9-,13+,15+/m1/s1 InChIKey: WSWWTQYHFCBKBT-DVJZZOLTSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9165) |
| Database reference: |
| AHTPDB: ID 1298, 3650, 4175, 4375, 4809, 4972, 5132, 5212, 5814, 6500 BioPepDB: biopep00419 BIOPEP-UWM database of bioactive peptides: ID 9165 J-GLOBAL: ID 200907049265642135 MBPDB: Peptide GTW Nikkaji: ID J2.440.040I PubChem: CID 102403413 SATPdb: ID satpdb27241 |