BIOPEP-UWM: Report
| ID | 7491 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 360.4066 | Monoisotopic mass | 360.1792 | |
| IC50 : | 240.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chen G. W., Tsai J. S., Pan B. S. | |
| Title | |
| Purification of angiotensin I-converting inhibitory peptides and antihypertensive effect of milk produced by protease-facilitate lactic fermentation. Int. Dairy J., 2007, 17, 641-647 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C18H24N4O4/c1-10(2)16(22-15(23)8-19)17(24)21-14(18(25)26)7-11-9-20-13-6-4-3-5-12(11)13/h3-6,9-10,14,16,20H,7-8,19H2,1-2H3,(H,21,24)(H,22,23)(H,25,26)/t14-,16-/m0/s1 InChIKey=COZMNNJEGNPDED-HOCLYGCPSA-N Hypouricemic peptide according to the BIOPEP-UWM database of bioactive peptides Hypotensive peptide according to the BIOPEP-UWM database of bioactive peptides; the DFBP database |
| Database reference: |
| AHTPDB: ID 3651, 4174, 4812, 4971, 5213, 5815, 6501 ChEBI: ID 164181 DFBP: ID DFBPACEI0665; DFBPANHY0566; DFBPMUFU0149 EROP-Moscow: ID E26429 J-GLOBAL: ID 200907057292666707 Metabolomics Workbench: ID 82253 Nikkaji: ID J2.440.041G PubChem: CID 102403414 |