BIOPEP-UWM: Report
ID | 7498 |
Name | ACE inhibitor from as2-CN |
sequence |
Function: | |||
Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
Number of residues | 3 |
Activity code | ah |
Activity : | ACE inhibitor |
|||
Chemical mass | 381.4224 | Monoisotopic mass | 381.1893 | |
EC50 : | 15.00 µM |
Bibliographic data: | |
Authors | |
Tauzin J., Miclo L., Gaillard J.-L. | |
Title | |
Angiotensin-I-converting enzyme inhibitory peptides from tryptic hydrolysate of bovine alphaS2-casein. FEBS Lett., 531, 369-374 | |
Year | Source |
2002 | Journal |
Additional information: |
BIOPEP database of bioactive peptides SMILES: N[C@@H]([C@@H](C)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O InChI=1S/C18H27N3O6/c1-9(2)15(21-16(24)14(19)10(3)22)17(25)20-13(18(26)27)8-11-4-6-12(23)7-5-11/h4-7,9-10,13-15,22-23H,8,19H2,1-3H3,(H,20,25)(H,21,24)(H,26,27)/t10-,13+,14+,15+/m1/s1 InChIKey: BPGDJSUFQKWUBK-KJEVXHAQSA-N |
Database reference: |
AHTPDB: ID: 1612; 2250; 4140; 4769; 5252; 5842; 6508 ChemSpider: ID 8243942 EROP-Moscow: ID E07433 PubChem: ID 10068402 SATPdb: ID satpdb16029 |