BIOPEP-UWM: Report
ID | 7499 |
Name | Name ACE inhibitor (from bovine alphas1-CN) |
sequence |
Function: | |||
Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
Number of residues | 4 |
Activity code | ah |
Activity : | ACE inhibitor |
|||
Chemical mass | 432.5120 | Monoisotopic mass | 432.2365 | |
IC50 : | 10.00 µM |
Bibliographic data: | |
Authors | |
Maruyama S., Nakagomi K., Tomizuka N., Suzuki H. | |
Title | |
Angiotensin I-converting enzyme inhibitor derived from an enzymatic hydrolysate of casein. Isolation and bradykinin-potentiating activity on the uterus. Agric. Biol. Chem., 49, 1405-1409 (1985) | |
Year | Source |
1985 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N2[C@@H](CCC2)C(=O)O InChI=1S/C22H32N4O5/c1-13(2)18(25-19(27)16(23)12-15-8-5-4-6-9-15)20(28)24-14(3)21(29)26-11-7-10-17(26)22(30)31/h4-6,8-9,13-14,16-18H,7,10-12,23H2,1-3H3,(H,24,28)(H,25,27)(H,30,31)/t14-,16-,17-,18-/m0/s1 InChIKey=PTCUFGUAPHEYOL-DKIMLUQUSA-N |
Database reference: |
AHTPDB: ID 2947, 4380, 4888, 5279, 5848, 6509 BindingDB: ID 50348862 BioPepDB: ID biopep00299 ChEMBL: ID CHEMBL1807679 ChemSpider: ID 26618430 EROP-Moscow: ID E14538 FeptideDB: ID 7499 PubChem: CID 56676985 SATPdb: ID satpdb28895 SureChEMBL: ID SCHEMBL10626642 ZINC: ID ZINC000072179329 |