BIOPEP-UWM: Report
| ID | 7501 |
| Name | Beta-casomorphin 8 - ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 8 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 887.0296 | Monoisotopic mass | 886.4574 | |
| IC50 : | 500.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Meisel H., Schlimme E. | |
| Title | |
| Inhibitors of angiotensin-converting enzyme derived from casein (casokinins)/beta-Casomorphins and related peptides: recent developments. Eds. Brantl V., Teschemacher H, VCH, Weinheim, 27-33, 1994 | |
| Year | Source |
| 1994 | book |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(Cc1ccc(O)cc1)C(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1CCC[C@@]1([H])C(=O)NCC(=O)N1CCC[C@@]1([H])C(=O)N[C@@]([H])([C@@H](C)CC)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C46H62N8O10/c1-3-28(2)39(45(62)54-24-10-16-37(54)46(63)64)50-42(59)35-14-7-21-51(35)38(56)27-48-40(57)34-13-8-23-53(34)44(61)33(26-29-11-5-4-6-12-29)49-41(58)36-15-9-22-52(36)43(60)32(47)25-30-17-19-31(55)20-18-30/h4-6,11-12,17-20,28,32-37,39,55H,3,7-10,13-16,21-27,47H2,1-2H3,(H,48,57)(H,49,58)(H,50,59)(H,63,64)/t28-,32-,33-,34-,35-,36-,37-,39-/m0/s1 InChIKey=NZONCMVKVLZPBL-AOAWOLJGSA-N Opioid peptide according to the BIOPEP-UWM database of bioactive peptides (ID 2869) Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10062); the MBPDB database |
| Database reference: |
| AHTPDB: ID 2500, 3453, 6511 BioPepDB: ID biopep01596 BIOPEP-UWM database of bioactive peptides: ID 2869; 10062 ChemSpider: ID 8299247 EROP-Moscow: ID E14735 FeptideDB: ID 3262; 7501 J-GLOBAL: ID 200907034037678319 MBPDB: Peptide YPFPGPIP Nikkaji: ID J39.401G PubChem: CID 10123728 SATPdb: ID satpdb20757 |