BIOPEP-UWM: Report
| ID | 7507 |
| Name | ACE inhibitor from Alaskan pollack skin |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 285.3385 | Monoisotopic mass | 285.1683 | |
| IC50 : | 13.93 µM |
|||
| Bibliographic data: | |
| Authors | |
| Byun H.-G., Kim S.-K. | |
| Title | |
| Structure and activity of angiotensin I-converting enzyme inhibitory peptides derived from Alaskan pollack skin. Bioch. Mol. Biol., 35, 2, 239-243, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@H](C(=O)NCC(=O)N[C@H](C(=O)O)CC(C)C)CCC1 InChI=1S/C13H23N3O4/c1-8(2)6-10(13(19)20)16-11(17)7-15-12(18)9-4-3-5-14-9/h8-10,14H,3-7H2,1-2H3,(H,15,18)(H,16,17)(H,19,20)/t9-,10-/m0/s1 InChIKey: FKLSMYYLJHYPHH-UWVGGRQHSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| AHTPDB: ID 4002; 5074; 6517 BioPepDB: ID biopep01046 BRENDA: Ligand Pro-Gly-Leu EROP-Moscow: ID E10410 PubChem: CID 145457472 SATPdb: ID satpdb25594 |