BIOPEP-UWM: Report
| ID | 7541 |
| Name | ACE inhibitor from wheat germ hydrolysate |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 393.4760 | Monoisotopic mass | 393.2256 | |
| IC50 : | 0.48 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ueno T., Tanaka M., Matsui T., Matsumoto K. | |
| Title | |
| Determination of antihypertensive small peptides, Val-Tyr and Ile-Val-Tyr, by fluorometric high-performance liquid chromatography combined with a double heart-cut column-swithcing technique. Anal. Sci., 2005, 21, 997-1000 | |
| Year | Source |
| 2005 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccc(cc1)O)C(C)C)[C@H](CC)C InChI=1S/C20H31N3O5/c1-5-12(4)16(21)18(25)23-17(11(2)3)19(26)22-15(20(27)28)10-13-6-8-14(24)9-7-13/h6-9,11-12,15-17,24H,5,10,21H2,1-4H3,(H,22,26)(H,23,25)(H,27,28)/t12-,15-,16-,17-/m0/s1 InChiKey: QSXSHZIRKTUXNG-STECZYCISA-N |
| Database reference: |
| AHTPDB: ID 1579; 1613; 1882; 1886; 2675; 2768; 2858; 3657; 3960; 4762; 5092; 5223; 5517; 5518; 5519; 6189; 6527 BindingDB: ID 50169207 BRENDA: Ligand Ile-Val-Tyr ChEMBL: ID CHEMBL188747 ChemSpider: ID 9398172 EROP-Moscow: ID E04070 PubChem: ID 11223118 |