BIOPEP-UWM: Report
| ID | 7559 |
| Name | ACE inhibitor from buckwheat |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 365.3801 | Monoisotopic mass | 365.1581 | |
| IC50 : | 16.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li C.-H., Matsui T., Matsumoto K., Yamasaki R., Kawasaki T. | |
| Title | |
| Latent production of Angiotensin I-converting enzyme inhibitors from buckwheat protein. J. Peptide Sci., 8, 267-274, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C17H23N3O6/c21-9-14(20-15(23)12-2-1-7-18-12)16(24)19-13(17(25)26)8-10-3-5-11(22)6-4-10/h3-6,12-14,18,21-22H,1-2,7-9H2,(H,19,24)(H,20,23)(H,25,26)/t12-,13-,14-/m0/s1 InChIKey=UGDMQJSXSSZUKL-IHRRRGAJSA-N Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) according to the BIOPEP-UWM Virtual database (ID 68) |
| Database reference: |
| AHTPDB: ID 1622, 1928, 2691, 4012, 5121, 5864, 6545 BioPepDB: ID biopep01104 BIOPEP-UWM Virtual database: ID 68 EROP-Moscow: ID E04101 FeptideDB: ID 7559 PlantPepDB: ID PPepDB_3016 PubChem: CID 145457580 SATPdb: ID satpdb16985 |