BIOPEP-UWM: Report
| ID | 7581 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 228.2873 | Monoisotopic mass | 228.1469 | |
| IC50 : | 130.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cheung H.-S., Wang F.-L., Ondetti M. A., Sabo E. F., Cushman D. W. | |
| Title | |
| Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. J. Biol. Chem., 255, 401-407, 1980 | |
| Year | Source |
| 1980 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C11H20N2O3/c1-3-7(2)9(12)10(14)13-6-4-5-8(13)11(15)16/h7-9H,3-6,12H2,1-2H3,(H,15,16)/t7-,8-,9-/m0/s1 InChIKey=BBIXOODYWPFNDT-CIUDSAMLSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8501); the BRENDA database; the EROP-Moscow database; the MBPDB database Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 489); the ChEMBL database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1501, 3018, 3075, 3220, 3352, 3418, 3500, 3565, 3788, 3862, 3952, 4443, 4494, 4673, 5865, 6567 BindingDB: ID 50348850 BioPepDB: ID biopep00554 BIOPEP-UWM database of bioactive peptides: ID 8501 BIOPEP-UWM database of sensory peptides and amino acids: ID 489 BRENDA: Ligand Ile-Pro ChEBI:ID 74076 ChEMBL: ID CHEMBL1807684 ChemSpider: ID 392673 EPA CompTox: ID DTXSID70332168 EPA DSSTox: ID DTXCID70283262 EROP-Moscow: ID E09205 FeptideDB: ID 7581; 8501 HMDB: ID HMDB0011174 J-GLOBAL: ID 200907051126439176 MBPDB: peptide IP Metabolights: ID MTBLC74076 Nikkaji: ID J608.440K PlantPepDB: ID PPepDB_3826 PubChem: CID 444876 SATPdb: ID satpdb19409 SureChEMBL: ID SCHEMBL231857 ZINC: ID ZINC000001591038 |