BIOPEP-UWM: Report
| ID | 7595 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 188.2236 | Monoisotopic mass | 188.1157 | |
| IC50 : | 1200.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cheung H.-S., Wang F.-L., Ondetti M. A., Sabo E. F., Cushman D. W. | |
| Title | |
| Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. J. Biol. Chem., 255, 401-407, 1980 | |
| Year | Source |
| 1980 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@H](C(=O)NCC(=O)O)[C@H](CC)C InChI=1S/C8H16N2O3/c1-3-5(2)7(9)8(13)10-4-6(11)12/h5,7H,3-4,9H2,1-2H3,(H,10,13)(H,11,12)/t5-,7-/m0/s1 InChIKey: UCGDDTHMMVWVMV-FSPLSTOPSA-N Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 164); the ChEMBL database; the PubChem database |
| Database reference: |
| AHTPDB: ID 1478; 1683; 3020; 3107; 3109; 3564; 3799; 3857; 3950; 4426; 4505; 6581 BindingDB: ID 50407434 BioPepDB: ID biopep00511 BIOPEP-UWM database of sensory peptides and amino acids: ID 164 ChEBI: ID 74066 ChEMBL: ID CHEMBL301979 ChemSpider: ID 5360987 EROP-Moscow: ID E10391 FeptideDB: ID 7595 J-GLOBAL: ID 200907055232808135 Metabolights: ID MTBLC133641 Metabolomics Workbench: ID 71880 Nikkaji: ID J265.924G PubChem: ID 6992869 SATPdb: ID satpdb14233 SureChEMBL: ID SCHEMBL8728266 ZINC: ID ZINC000001590840 |