BIOPEP-UWM: Report
| ID | 7623 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin I-converting enzyme (EC 3.4.15.1; MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 218.2066 | Monoisotopic mass | 218.0899 | |
| IC50 : | 10000.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cheung H.-S., Wang F.-L., Ondetti M. A., Sabo E. F., Cushman D. W. | |
| Title | |
| Inhibitor of angiotensin I-converting enzyme (EC 3.4.15.1; MEROPS ID: M02-001) | |
| Year | Source |
| 1980 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C8H14N2O5/c1-4(8(14)15)10-7(13)5(9)2-3-6(11)12/h4-5H,2-3,9H2,1H3,(H,10,13)(H,11,12)(H,14,15)/t4-,5-/m0/s1 InChIKey: JZDHUJAFXGNDSB-WHFBIAKZSA-N Inhibitor of alpha-glucosidase (EC 3.2.1.20) according to the BIOPEP-UWM database of bioactive peptides (ID 9650) Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 362) Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 363) |
| Database reference: |
| ACToR: ID 21064-18-6 AHTPDB: ID 2997; 3032; 3046; 3071; 3255; 3359; 3427; 3472; 3555; 3836; 3897; 4397; 4542; 4696; 6610 BindingDB: ID 50169155 BioPepDB: ID biopep00162 BIOPEP-UWM database of bioactive peptides: ID 9650 BIOPEP-UWM database of sensory peptides and amino acids: ID 362; 363 BRENDA: Ligand Glu-Ala ChEBI: ID 73849 ChemIDplus: ID 21064-18-6 ChEMBL: ID CHEMBL90074 ChemSpider: ID 5360636 CTD: 21064-18-6 HMDB: ID HMDB0003764 J-GLOBAL: ID 200907083878894890 Metabolights: ID MTBLC73849 Nikkaji: ID J150.577G PubChem: ID 6992506 SATPdb: ID satpdb18482 SDBS: ID NMR-CDS-07-416 SureChEMBL: ID SCHEMBL751142 ZINC: ID ZINC01576200 |