BIOPEP-UWM: Report
| ID | 7626 |
| Name | ACE inhibitor from kappa-CN (fr. 22-24) |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 330.4219 | Monoisotopic mass | 330.2260 | |
| IC50 : | 15.70 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gómez-Ruiz J. A., Ramos M., Recio I. | |
| Title | |
| Identification of novel angiotensin-converting enzyme-inhibitory peptides from ovine milk proteins by CE-MS and chromatographic techniques. Electrophoresis, 28, 4202-4211, 2007 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C15H30N4O4/c1-4-9(2)12(17)14(21)18-10(3)13(20)19-11(15(22)23)7-5-6-8-16/h9-12H,4-8,16-17H2,1-3H3,(H,18,21)(H,19,20)(H,22,23)/t9-,10-,11-,12-/m0/s1 InChIKey=RWIKBYVJQAJYDP-BJDJZHNGSA-N Antibacterial peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10105); the EROP-Moscow database; the MBPDB database Hypotensive peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10106); the MBPDB database |
| Database reference: |
| AHTPDB: ID 1001, 1733, 2632, 3118, 4153, 4187, 4322, 4967, 5866, 6613 BIOPEP-UWM database of bioactive peptides: ID 10105, 10106 CHEBI: ID 158148 ChemSpider: ID 8217854 EROP-Moscow: ID E14720 FeptideDB: ID 7626 MBPDB: Peptide IAK PubChem: CID 10042290 SATPdb: ID satpdb12659 |