BIOPEP-UWM: Report
| ID | 7632 |
| Name | ACE inhibitor from beta-Lg (fr. 7-9) – Wheylin-2 |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 334.4350 | Monoisotopic mass | 334.1669 | |
| IC50 : | 71.85 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernández-Ledesma B., Ramos M., Recio I., Amigo L. | |
| Title | |
| Effect of beta-lactoglobulin hydrolysis with thermolysin under denaturing temperatures on the release of bioactive peptides. J. Chromatogr. A, 1116, 31-37, 2006 | |
| Year | Source |
| 2006 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCCCN)C(=O)NCC(=O)O InChI=1S/C13H26N4O4S/c1-22-7-5-9(15)12(20)17-10(4-2-3-6-14)13(21)16-8-11(18)19/h9-10H,2-8,14-15H2,1H3,(H,16,21)(H,17,20)(H,18,19)/t9-,10-/m0/s1 InChIKey=AXHNAGAYRGCDLG-UWVGGRQHSA-N Anxiolytic-like peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10112) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10112 ChEBI: ID 160899 ChemSpider: ID 7994817 EROP-Moscow: ID E23851 FeptideDB: ID 7632 J-GLOBAL: ID 200907039921917620 MBPDB: peptide MKG Nikkaji: ID J2.319.168G MeSH: term Wheylin-2 PubChem: CID 9819068 |