BIOPEP-UWM: Report
| ID | 7664 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 481.5841 | Monoisotopic mass | 481.2891 | |
| EC50 : | 79.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K., Chen J.-R. | |
| Title | |
| Identification of antihypertensive peptides from peptic digest of two microalgae, Chlorella vulgaris and Spirulina platensis. Marine Biotechnol., 3, 305–309, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C23H39N5O6/c1-12(2)17(24)20(30)26-18(13(3)4)22(32)28-11-7-9-16(28)21(31)27-10-6-8-15(27)19(29)25-14(5)23(33)34/h12-18H,6-11,24H2,1-5H3,(H,25,29)(H,26,30)(H,33,34)/t14-,15-,16-,17-,18-/m0/s1 InChIKey: YDURAHOGQWSWPJ-ATIWLJMLSA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| AHTPDB: ID 1034, 1865, 2435 SATPdb: ID satpdb15950 |