BIOPEP-UWM: Report
| ID | 7685 |
| Name | ACE inhibitor from garlic |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-converting Enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 252.2658 | Monoisotopic mass | 252.1106 | |
| IC50 : | 130.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K. | |
| Title | |
| Isolation and characterization of angiotensin I-converting enzyme inhibitor dipeptides derived from Allium sativum L (garlic). J. Nutr. Biochem., 9, 415-419, 1998 | |
| Year | Source |
| 1998 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C12H16N2O4/c13-9(7-15)11(16)14-10(12(17)18)6-8-4-2-1-3-5-8/h1-5,9-10,15H,6-7,13H2,(H,14,16)(H,17,18)/t9-,10-/m0/s1 InChIKey: PPQRSMGDOHLTBE-UWVGGRQHSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8891) Inhibitor of Renin (EC 3.4.23.15) (MEROPS ID A01.007) according to the BIOPEP-UWM database of bioactive peptides (ID 9432) |
| Database reference: |
| AHTPDB: ID 1382, 1696, 1812, 2656, 3267, 3364, 3537, 3584, 4025, 4709, 5172, 5743, 5869, 6671 BioCyc: ID CPD-20388 BioPepDB: ID biopep01237 BIOPEP-UWM database of bioactive peptides: ID 8891; 9432 BRENDA: Ligand Ser-Phe ChEBI: ID 71029 ChEMBL: ID CHEMBL3321990 ChemSpider: ID 5373177 EROP-Moscow: ID E09344 J-GLOBAL: ID 200907032654367891 Metabolights: ID MTBLC71029 Nikkaji: ID J151.049E PubChem: CID 7009597 SATPdb: ID satpdb18279 SDBS: ID 8349 SureChEMBL: ID SCHEMBL9622556 ZINC: ID ZINC000002384818 |