BIOPEP-UWM: Report
| ID | 7751 |
| Name | ACE inhibitor from shark meat hydrolysate |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 268.3325 | Monoisotopic mass | 268.0878 | |
| IC50 : | 1.96 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wu H., He H-L, Chen X-L, Sun C-Y, Zhang Y-Z, Zhou B-C. | |
| Title | |
| Purification and identification of novel angiotensin I-converting enzyme inhibitory peptides from shark meat hydrolysate. Process Biochemistry, 43, 457-461, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C12H16N2O3S/c13-9(7-18)11(15)14-10(12(16)17)6-8-4-2-1-3-5-8/h1-5,9-10,18H,6-7,13H2,(H,14,15)(H,16,17)/t9-,10-/m0/s1 InChIKey=XZFYRXDAULDNFX-UWVGGRQHSA-N |
| Database reference: |
| AHTPDB: ID 1114, 2818, 3184, 4707, 5139, 6192, 6699 BioPepDB: ID biopep00112 ChemSpider: ID57558034 EPA DSSTox: ID DTXCID60599309 EROP-Moscow: ID E23532 FeptideDB: ID 7751 J-GLOBAL: ID 200907029315775262 Nikkaji: ID J2.409.584C PubChem: CID 25051327 SATPdb: ID satpdb17537 |