BIOPEP-UWM: Report
| ID | 7771 |
| Name | PKC inhibitor |
| sequence |
| Function: | |||
| Number of residues | 4 |
Activity code | PKC |
| Activity : | Protein Kinase C inhibitor |
|||
| Chemical mass | 467.5180 | Monoisotopic mass | 467.2485 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Perdomo-Arciniegas A. M., Patarroyo M. E., Vernot J.-P. | |
| Title | |
| Novel chimeric peptide inhibits Protein Kinase C and induces apoptosis in human immune cells. Int. J. Pep.Res. Ther., 2008, 14, 64-74 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C20H33N7O6/c21-6-2-1-4-14(25-17(29)13(22)8-12-9-23-11-24-12)19(31)27-7-3-5-16(27)18(30)26-15(10-28)20(32)33/h9,11,13-16,28H,1-8,10,21-22H2,(H,23,24)(H,25,29)(H,26,30)(H,32,33)/t13-,14-,15-,16-/m0/s1 InChIKey=LGSIHNDKQLKQMC-VGWMRTNUSA-N |
| Database reference: |