BIOPEP-UWM: Report
| ID | 7803 |
| Name | ACE inhibitor from as2-casein |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 391.4602 | Monoisotopic mass | 391.2100 | |
| IC50 : | 206.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gómez-Ruiz J. A., Ramos M., Recio I. | |
| Title | |
| Angiotensin-converting enzyme-inhibitory peptides in Manchego cheeses manufactured with different starter cultures. Int. Dairy J., 12, 697-706, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C20H29N3O5/c1-3-12(2)17(21)19(26)23-10-4-5-16(23)18(25)22-15(20(27)28)11-13-6-8-14(24)9-7-13/h6-9,12,15-17,24H,3-5,10-11,21H2,1-2H3,(H,22,25)(H,27,28)/t12-,15-,16-,17-/m0/s1 InChIKey=XOZOSAUOGRPCES-STECZYCISA-N Antioxidative peptide according to the EROP-Moscow database Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 2259, 3955, 5700, 6706 BioPepDB: ID biopep00570 BRENDA: Ligand Ile-Pro-Tyr EROP-Moscow: ID E10838 FeptideDB: ID 7803 MBPDB: Peptide IPY PlantPepDB: ID PPepDB_87 PubChem: CID 14889694 SATPdb: ID satpdb28171 |